C10H16IN3 — CID 163474338
3-methyl-5-(piperidin-1-ylmethyl)-1λ3-ioda-2,6-diazacyclohexa-1,3,5-triene (PubChem CID 163474338) has the molecular formula C10H16IN3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 3-methyl-5-(piperidin-1-ylmethyl)-1λ3-ioda-2,6-diazacyclohexa-1,3,5-triene.
| Compound Name | 3-methyl-5-(piperidin-1-ylmethyl)-1λ3-ioda-2,6-diazacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 163474338 |
| Molecular Formula | C10H16IN3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-methyl-5-(piperidin-1-ylmethyl)-1λ3-ioda-2,6-diazacyclohexa-1,3,5-triene |
| SMILES | CC1=CC(CN2CCCCC2)=NI=N1 |
| InChI | InChI=1S/C10H16IN3/c1-9-7-10(13-11-12-9)8-14-5-3-2-4-6-14/h7H,2-6,8H2,1H3 |
| InChIKey | BZDZLLQQGPQPTC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|