C16H21N3O2 — CID 913667
4-(butanoylamino)-N-(1-cyclopropylethylideneamino)benzamide (PubChem CID 913667) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 4-(butanoylamino)-N-(1-cyclopropylethylideneamino)benzamide.
| Compound Name | 4-(butanoylamino)-N-(1-cyclopropylethylideneamino)benzamide |
|---|---|
| PubChem CID | 913667 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 4-(butanoylamino)-N-(1-cyclopropylethylideneamino)benzamide |
| SMILES | CCCC(=O)Nc1ccc(C(=O)NN=C(C)C2CC2)cc1 |
| InChI | InChI=1S/C16H21N3O2/c1-3-4-15(20)17-14-9-7-13(8-10-14)16(21)19-18-11(2)12-5-6-12/h7-10,12H,3-6H2,1-2H3,(H,17,20)(H,19,21) |
| InChIKey | OEOPSZRHAGDUCG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|