C21H30O — CID 91368355
2-[(7R,8S,9S,13S,14S,17S)-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethenone (PubChem CID 91368355) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is 2-[(7R,8S,9S,13S,14S,17S)-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethenone.
| Compound Name | 2-[(7R,8S,9S,13S,14S,17S)-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethenone |
|---|---|
| PubChem CID | 91368355 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2-[(7R,8S,9S,13S,14S,17S)-7,13-dimethyl-1,2,3,4,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethenone |
| SMILES | C[C@@H]1CC2=C(CCCC2)[C@H]2CC[C@]3(C)[C@H](C=C=O)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C21H30O/c1-14-13-15-5-3-4-6-17(15)18-9-11-21(2)16(10-12-22)7-8-19(21)20(14)18/h10,14,16,18-20H,3-9,11,13H2,1-2H3/t14-,16+,18-,19+,20-,21-/m1/s1 |
| InChIKey | PPEZWULPDSPUKL-RPNQKPKCSA-N |
| XLogP | 5.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|