C20H31KO — CID 70146214
potassium;(7R,8R,9R,13S)-7,13-dimethyl-3-methylidene-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene;hydroxide (PubChem CID 70146214) has the molecular formula C20H31KO and a molecular weight of 326.57 g/mol. Its IUPAC name is potassium;(7R,8R,9R,13S)-7,13-dimethyl-3-methylidene-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene;hydroxide.
| Compound Name | potassium;(7R,8R,9R,13S)-7,13-dimethyl-3-methylidene-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene;hydroxide |
|---|---|
| PubChem CID | 70146214 |
| Molecular Formula | C20H31KO |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | potassium;(7R,8R,9R,13S)-7,13-dimethyl-3-methylidene-2,4,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene;hydroxide |
| SMILES | C=C1CCC2=C(C1)C[C@@H](C)[C@@H]1C3CCC[C@@]3(C)CC[C@@H]21.[K+].[OH-] |
| InChI | InChI=1S/C20H30.K.H2O/c1-13-6-7-16-15(11-13)12-14(2)19-17(16)8-10-20(3)9-4-5-18(19)20;;/h14,17-19H,1,4-12H2,2-3H3;;1H2/q;+1;/p-1/t14-,17+,18?,19+,20+;;/m1../s1 |
| InChIKey | XJDPZBXWGJPPPS-FBQGWVTLSA-M |
| XLogP | 2.72 |
| TPSA | 30.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|