C21H28O4 — CID 67743523
[(7R,8S,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 67743523) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is [(7R,8S,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(7R,8S,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 67743523 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | [(7R,8S,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(O)c1O)[C@H]1CC[C@]3(C)CCC[C@H]3[C@@H]1[C@H](C)C2 |
| InChI | InChI=1S/C21H28O4/c1-11-9-13-10-16(25-12(2)22)19(23)20(24)18(13)14-6-8-21(3)7-4-5-15(21)17(11)14/h10-11,14-15,17,23-24H,4-9H2,1-3H3/t11-,14+,15+,17-,21+/m1/s1 |
| InChIKey | PRYYEPCYYLAPTA-DTRDTRJSSA-N |
| XLogP | 4.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|