C21H26O5 — CID 67743507
[(7R,8R,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 67743507) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is [(7R,8R,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(7R,8R,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 67743507 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | [(7R,8R,9S,13S,14S)-1,2-dihydroxy-7,13-dimethyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)Oc1cc2c(c(O)c1O)[C@H]1CC[C@]3(C)C(=O)CC[C@H]3[C@@H]1[C@H](C)C2 |
| InChI | InChI=1S/C21H26O5/c1-10-8-12-9-15(26-11(2)22)19(24)20(25)18(12)13-6-7-21(3)14(17(10)13)4-5-16(21)23/h9-10,13-14,17,24-25H,4-8H2,1-3H3/t10-,13+,14+,17-,21+/m1/s1 |
| InChIKey | AUPNNCZYJSGUQU-PFQYVLEFSA-N |
| XLogP | 3.69 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|