C19H24O4 — CID 624475
3,6,7-trihydroxy-1,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 624475) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 3,6,7-trihydroxy-1,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | 3,6,7-trihydroxy-1,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 624475 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 3,6,7-trihydroxy-1,13-dimethyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | Cc1cc(O)cc2c1C1CCC3(C)C(=O)CCC3C1C(O)C2O |
| InChI | InChI=1S/C19H24O4/c1-9-7-10(20)8-12-15(9)11-5-6-19(2)13(3-4-14(19)21)16(11)18(23)17(12)22/h7-8,11,13,16-18,20,22-23H,3-6H2,1-2H3 |
| InChIKey | ALMITNPJAQXIPS-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |