C20H28O3 — CID 70137508
(8S,9S,13S,14S,17R)-1-methoxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 70137508) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (8S,9S,13S,14S,17R)-1-methoxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,13S,14S,17R)-1-methoxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 70137508 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (8S,9S,13S,14S,17R)-1-methoxy-7,13-dimethyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | COc1cc(O)cc2c1[C@H]1CC[C@]3(C)[C@H](O)CC[C@H]3[C@@H]1C(C)C2 |
| InChI | InChI=1S/C20H28O3/c1-11-8-12-9-13(21)10-16(23-3)19(12)14-6-7-20(2)15(18(11)14)4-5-17(20)22/h9-11,14-15,17-18,21-22H,4-8H2,1-3H3/t11?,14-,15-,17+,18+,20-/m0/s1 |
| InChIKey | KGRFOITZMALJNT-ZIWKCEFCSA-N |
| XLogP | 3.86 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |