C24H33NO4 — CID 68518924
[(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] hydrogen carbonate (PubChem CID 68518924) has the molecular formula C24H33NO4 and a molecular weight of 399.53 g/mol. Its IUPAC name is [(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] hydrogen carbonate.
| Compound Name | [(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 68518924 |
| Molecular Formula | C24H33NO4 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | [(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl] hydrogen carbonate |
| SMILES | CC(C)(C)C(=O)Nc1cc2c(cc1OC(=O)O)CCC1C2CC[C@]2(C)CCCC12 |
| InChI | InChI=1S/C24H33NO4/c1-23(2,3)21(26)25-19-13-17-14(12-20(19)29-22(27)28)7-8-16-15(17)9-11-24(4)10-5-6-18(16)24/h12-13,15-16,18H,5-11H2,1-4H3,(H,25,26)(H,27,28)/t15?,16?,18?,24-/m0/s1 |
| InChIKey | XKPZCVBHBJYMOW-QFWPPKASSA-N |
| XLogP | 5.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|