C23H34NO4P — CID 66818716
[(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid (PubChem CID 66818716) has the molecular formula C23H34NO4P and a molecular weight of 419.50 g/mol. Its IUPAC name is [(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid.
| Compound Name | [(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid |
|---|---|
| PubChem CID | 66818716 |
| Molecular Formula | C23H34NO4P |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | [(13S)-2-(2,2-dimethylpropanoylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-yl]phosphonic acid |
| SMILES | CC(C)(C)C(=O)Nc1cc2c(cc1P(=O)(O)O)CCC1C2CC[C@]2(C)CCCC12 |
| InChI | InChI=1S/C23H34NO4P/c1-22(2,3)21(25)24-19-13-17-14(12-20(19)29(26,27)28)7-8-16-15(17)9-11-23(4)10-5-6-18(16)23/h12-13,15-16,18H,5-11H2,1-4H3,(H,24,25)(H2,26,27,28)/t15?,16?,18?,23-/m0/s1 |
| InChIKey | WPJOECFICKQHRF-ZSGVZDPESA-N |
| XLogP | 4.72 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|