C17H26O7 — CID 91368416
[2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] undec-10-enoate (PubChem CID 91368416) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] undec-10-enoate.
| Compound Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] undec-10-enoate |
|---|---|
| PubChem CID | 91368416 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | [2-hydroxy-2-(4-hydroxy-3,5-dioxooxolan-2-yl)ethyl] undec-10-enoate |
| SMILES | C=CCCCCCCCCC(=O)OCC(O)C1OC(=O)C(O)C1=O |
| InChI | InChI=1S/C17H26O7/c1-2-3-4-5-6-7-8-9-10-13(19)23-11-12(18)16-14(20)15(21)17(22)24-16/h2,12,15-16,18,21H,1,3-11H2 |
| InChIKey | VHALGNJQLPMGHS-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|