C36H44N2O7 — CID 91369201
9H-fluoren-9-ylmethyl N-[(2R)-1-[[2,6-dimethoxy-4-(5-oxohexoxy)phenyl]methyl-propan-2-ylamino]-1-oxopropan-2-yl]carbamate (PubChem CID 91369201) has the molecular formula C36H44N2O7 and a molecular weight of 616.75 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R)-1-[[2,6-dimethoxy-4-(5-oxohexoxy)phenyl]methyl-propan-2-ylamino]-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R)-1-[[2,6-dimethoxy-4-(5-oxohexoxy)phenyl]methyl-propan-2-ylamino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 91369201 |
| Molecular Formula | C36H44N2O7 |
| Molecular Weight | 616.75 g/mol |
| Exact Mass | 616.31 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R)-1-[[2,6-dimethoxy-4-(5-oxohexoxy)phenyl]methyl-propan-2-ylamino]-1-oxopropan-2-yl]carbamate |
| SMILES | COc1cc(OCCCCC(C)=O)cc(OC)c1CN(C(=O)[C@@H](C)NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C |
| InChI | InChI=1S/C36H44N2O7/c1-23(2)38(21-31-33(42-5)19-26(20-34(31)43-6)44-18-12-11-13-24(3)39)35(40)25(4)37-36(41)45-22-32-29-16-9-7-14-27(29)28-15-8-10-17-30(28)32/h7-10,14-17,19-20,23,25,32H,11-13,18,21-22H2,1-6H3,(H,37,41)/t25-/m1/s1 |
| InChIKey | KKBFHGCNWAJYCZ-RUZDIDTESA-N |
| XLogP | 6.51 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.75 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|