C41H51F3N2O10 — CID 22942067
5-[4-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-(4,4,4-trifluoro-1,1-dimethoxybutan-2-yl)amino]methyl]-3,5-dimethoxyphenoxy]pentanoic acid (PubChem CID 22942067) has the molecular formula C41H51F3N2O10 and a molecular weight of 788.86 g/mol. Its IUPAC name is 5-[4-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-(4,4,4-trifluoro-1,1-dimethoxybutan-2-yl)amino]methyl]-3,5-dimethoxyphenoxy]pentanoic acid.
| Compound Name | 5-[4-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-(4,4,4-trifluoro-1,1-dimethoxybutan-2-yl)amino]methyl]-3,5-dimethoxyphenoxy]pentanoic acid |
|---|---|
| PubChem CID | 22942067 |
| Molecular Formula | C41H51F3N2O10 |
| Molecular Weight | 788.86 g/mol |
| Exact Mass | 788.35 |
| IUPAC Name | 5-[4-[[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]-(4,4,4-trifluoro-1,1-dimethoxybutan-2-yl)amino]methyl]-3,5-dimethoxyphenoxy]pentanoic acid |
| SMILES | COc1cc(OCCCCC(=O)O)cc(OC)c1CN(C(=O)[C@H](CC(C)C)NC(=O)OCC1c2ccccc2-c2ccccc21)C(CC(F)(F)F)C(OC)OC |
| InChI | InChI=1S/C41H51F3N2O10/c1-25(2)19-33(45-40(50)56-24-32-29-15-9-7-13-27(29)28-14-8-10-16-30(28)32)38(49)46(34(22-41(42,43)44)39(53-5)54-6)23-31-35(51-3)20-26(21-36(31)52-4)55-18-12-11-17-37(47)48/h7-10,13-16,20-21,25,32-34,39H,11-12,17-19,22-24H2,1-6H3,(H,45,50)(H,47,48)/t33-,34?/m0/s1 |
| InChIKey | WUEIOTSAAGWGAR-CDRRMRQFSA-N |
| XLogP | 7.56 |
| TPSA | 142.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.86 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|