C19H25N3O2 — CID 91370032
(2S,3S)-N-[(2,4-dimethoxy-3-pyridinyl)methyl]-2-phenylpiperidin-3-amine (PubChem CID 91370032) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (2S,3S)-N-[(2,4-dimethoxy-3-pyridinyl)methyl]-2-phenylpiperidin-3-amine.
| Compound Name | (2S,3S)-N-[(2,4-dimethoxy-3-pyridinyl)methyl]-2-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 91370032 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | (2S,3S)-N-[(2,4-dimethoxy-3-pyridinyl)methyl]-2-phenylpiperidin-3-amine |
| SMILES | COc1ccnc(OC)c1CN[C@H]1CCCN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H25N3O2/c1-23-17-10-12-21-19(24-2)15(17)13-22-16-9-6-11-20-18(16)14-7-4-3-5-8-14/h3-5,7-8,10,12,16,18,20,22H,6,9,11,13H2,1-2H3/t16-,18-/m0/s1 |
| InChIKey | FOQABHHFJWGKDF-WMZOPIPTSA-N |
| XLogP | 2.68 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |