C29H30N2O3 — CID 91370091
(1-carbamoyl-3-phenylpiperidin-4-yl) 2-(4-phenylphenyl)pent-4-enoate (PubChem CID 91370091) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is (1-carbamoyl-3-phenylpiperidin-4-yl) 2-(4-phenylphenyl)pent-4-enoate.
| Compound Name | (1-carbamoyl-3-phenylpiperidin-4-yl) 2-(4-phenylphenyl)pent-4-enoate |
|---|---|
| PubChem CID | 91370091 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (1-carbamoyl-3-phenylpiperidin-4-yl) 2-(4-phenylphenyl)pent-4-enoate |
| SMILES | C=CCC(C(=O)OC1CCN(C(N)=O)CC1c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H30N2O3/c1-2-9-25(24-16-14-22(15-17-24)21-10-5-3-6-11-21)28(32)34-27-18-19-31(29(30)33)20-26(27)23-12-7-4-8-13-23/h2-8,10-17,25-27H,1,9,18-20H2,(H2,30,33) |
| InChIKey | QEZALBNKQSPZQV-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|