C42H46F2N2O5 — CID 70531461
bis(cyclopropyl-[(3S,4R)-4-(4-fluorophenoxy)-3-phenylpiperidin-1-yl]methanone);hydrate (PubChem CID 70531461) has the molecular formula C42H46F2N2O5 and a molecular weight of 696.84 g/mol. Its IUPAC name is bis(cyclopropyl-[(3S,4R)-4-(4-fluorophenoxy)-3-phenylpiperidin-1-yl]methanone);hydrate.
| Compound Name | bis(cyclopropyl-[(3S,4R)-4-(4-fluorophenoxy)-3-phenylpiperidin-1-yl]methanone);hydrate |
|---|---|
| PubChem CID | 70531461 |
| Molecular Formula | C42H46F2N2O5 |
| Molecular Weight | 696.84 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | bis(cyclopropyl-[(3S,4R)-4-(4-fluorophenoxy)-3-phenylpiperidin-1-yl]methanone);hydrate |
| SMILES | O.O=C(C1CC1)N1CC[C@@H](Oc2ccc(F)cc2)[C@@H](c2ccccc2)C1.O=C(C1CC1)N1CC[C@@H](Oc2ccc(F)cc2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/2C21H22FNO2.H2O/c2*22-17-8-10-18(11-9-17)25-20-12-13-23(21(24)16-6-7-16)14-19(20)15-4-2-1-3-5-15;/h2*1-5,8-11,16,19-20H,6-7,12-14H2;1H2/t2*19-,20-;/m11./s1 |
| InChIKey | HRRKXNGIHAXBSI-DATDMCEVSA-N |
| XLogP | 7.17 |
| TPSA | 90.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.84 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |