C23H27NO5 — CID 86738223
(E)-but-2-enedioic acid;(3R,4S)-1-methyl-4-(4-methylphenoxy)-3-phenylpiperidine (PubChem CID 86738223) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(3R,4S)-1-methyl-4-(4-methylphenoxy)-3-phenylpiperidine.
| Compound Name | (E)-but-2-enedioic acid;(3R,4S)-1-methyl-4-(4-methylphenoxy)-3-phenylpiperidine |
|---|---|
| PubChem CID | 86738223 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (E)-but-2-enedioic acid;(3R,4S)-1-methyl-4-(4-methylphenoxy)-3-phenylpiperidine |
| SMILES | Cc1ccc(O[C@H]2CCN(C)C[C@H]2c2ccccc2)cc1.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H23NO.C4H4O4/c1-15-8-10-17(11-9-15)21-19-12-13-20(2)14-18(19)16-6-4-3-5-7-16;5-3(6)1-2-4(7)8/h3-11,18-19H,12-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t18-,19-;/m0./s1 |
| InChIKey | LOJSBOVKYQCJMS-DBHVVPLHSA-N |
| XLogP | 3.57 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|