C21H22FNO5 — CID 70513906
but-2-enedioic acid;(3R,4R)-4-(4-fluorophenoxy)-3-phenylpiperidine (PubChem CID 70513906) has the molecular formula C21H22FNO5 and a molecular weight of 387.41 g/mol. Its IUPAC name is but-2-enedioic acid;(3R,4R)-4-(4-fluorophenoxy)-3-phenylpiperidine.
| Compound Name | but-2-enedioic acid;(3R,4R)-4-(4-fluorophenoxy)-3-phenylpiperidine |
|---|---|
| PubChem CID | 70513906 |
| Molecular Formula | C21H22FNO5 |
| Molecular Weight | 387.41 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | but-2-enedioic acid;(3R,4R)-4-(4-fluorophenoxy)-3-phenylpiperidine |
| SMILES | Fc1ccc(O[C@@H]2CCNC[C@H]2c2ccccc2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C17H18FNO.C4H4O4/c18-14-6-8-15(9-7-14)20-17-10-11-19-12-16(17)13-4-2-1-3-5-13;5-3(6)1-2-4(7)8/h1-9,16-17,19H,10-12H2;1-2H,(H,5,6)(H,7,8)/t16-,17+;/m0./s1 |
| InChIKey | DIMQIFGWVWXWGL-MCJVGQIASA-N |
| XLogP | 3.06 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.41 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|