C17H23NO6 — CID 70544199
but-2-enedioic acid;(3R,4R)-4-(2,3-dimethylphenoxy)piperidin-3-ol (PubChem CID 70544199) has the molecular formula C17H23NO6 and a molecular weight of 337.37 g/mol. Its IUPAC name is but-2-enedioic acid;(3R,4R)-4-(2,3-dimethylphenoxy)piperidin-3-ol.
| Compound Name | but-2-enedioic acid;(3R,4R)-4-(2,3-dimethylphenoxy)piperidin-3-ol |
|---|---|
| PubChem CID | 70544199 |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | but-2-enedioic acid;(3R,4R)-4-(2,3-dimethylphenoxy)piperidin-3-ol |
| SMILES | Cc1cccc(O[C@@H]2CCNC[C@H]2O)c1C.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C13H19NO2.C4H4O4/c1-9-4-3-5-12(10(9)2)16-13-6-7-14-8-11(13)15;5-3(6)1-2-4(7)8/h3-5,11,13-15H,6-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/t11-,13-;/m1./s1 |
| InChIKey | SKBPOIWDCNBNNG-LOCPCMAASA-N |
| XLogP | 1.12 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|