C15H23NO4S — CID 13192287
5-(2,3-dimethylphenoxy)-1-methylsulfonylazepan-4-ol (PubChem CID 13192287) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-(2,3-dimethylphenoxy)-1-methylsulfonylazepan-4-ol.
| Compound Name | 5-(2,3-dimethylphenoxy)-1-methylsulfonylazepan-4-ol |
|---|---|
| PubChem CID | 13192287 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 5-(2,3-dimethylphenoxy)-1-methylsulfonylazepan-4-ol |
| SMILES | Cc1cccc(OC2CCN(S(C)(=O)=O)CCC2O)c1C |
| InChI | InChI=1S/C15H23NO4S/c1-11-5-4-6-14(12(11)2)20-15-8-10-16(21(3,18)19)9-7-13(15)17/h4-6,13,15,17H,7-10H2,1-3H3 |
| InChIKey | XPRXFNNXWPRLCB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |