4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid

C14H19NO4 — CID 69056858

IUPAC4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid
SMILESCc1cccc(OC2CCN(C(=O)O)CC2O)c1C
InChIInChI=1S/C14H19NO4/c1-9-4-3-5-12(10(9)2)19-13-6-7-15(14(17)18)8-11(13)16/h3-5,11,13,16H,6-8H2,1-2H3,(H,17,18)
InChIKeyGCCRRSMGPUNTRJ-UHFFFAOYSA-N
MW265.31 g/mol
LogP1.80
Rot. Bonds2

About 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid

4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid (PubChem CID 69056858) has the molecular formula C14H19NO4 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid.

Molecular Properties

Compound Name4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid
PubChem CID69056858
Molecular FormulaC14H19NO4
Molecular Weight265.31 g/mol
Exact Mass265.13
IUPAC Name4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid
SMILESCc1cccc(OC2CCN(C(=O)O)CC2O)c1C
InChIInChI=1S/C14H19NO4/c1-9-4-3-5-12(10(9)2)19-13-6-7-15(14(17)18)8-11(13)16/h3-5,11,13,16H,6-8H2,1-2H3,(H,17,18)
InChIKeyGCCRRSMGPUNTRJ-UHFFFAOYSA-N
XLogP1.80
TPSA70.00 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.31
LogP ≤ 51.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid?
The IUPAC name of 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid (CID 69056858) is 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid.
What is the SMILES notation for 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid?
The canonical SMILES for 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid is Cc1cccc(OC2CCN(C(=O)O)CC2O)c1C.
What is the InChIKey of 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid?
The InChIKey is GCCRRSMGPUNTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO4/c1-9-4-3-5-12(10(9)2)19-13-6-7-15(14(17)18)8-11(13)16/h3-5,11,13,16H,6-8H2,1-2H3,(H,17,18).
What are the key properties of 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid?
4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid has a molecular weight of 265.31 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dimethylphenoxy)-3-hydroxypiperidine-1-carboxylic acid is sourced from PubChem (CID 69056858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).