C14H17NO3S — CID 91370144
2-(1-benzofuran-5-yl)-1-methylsulfonylpiperidine (PubChem CID 91370144) has the molecular formula C14H17NO3S and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-(1-benzofuran-5-yl)-1-methylsulfonylpiperidine.
| Compound Name | 2-(1-benzofuran-5-yl)-1-methylsulfonylpiperidine |
|---|---|
| PubChem CID | 91370144 |
| Molecular Formula | C14H17NO3S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | 2-(1-benzofuran-5-yl)-1-methylsulfonylpiperidine |
| SMILES | CS(=O)(=O)N1CCCCC1c1ccc2occc2c1 |
| InChI | InChI=1S/C14H17NO3S/c1-19(16,17)15-8-3-2-4-13(15)11-5-6-14-12(10-11)7-9-18-14/h5-7,9-10,13H,2-4,8H2,1H3 |
| InChIKey | AUIAKQQAEKFGON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |