C10H10N2S — CID 91371519
1,3,9,9a-tetrahydrothieno[3,4-b]quinoxaline (PubChem CID 91371519) has the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. Its IUPAC name is 1,3,9,9a-tetrahydrothieno[3,4-b]quinoxaline.
| Compound Name | 1,3,9,9a-tetrahydrothieno[3,4-b]quinoxaline |
|---|---|
| PubChem CID | 91371519 |
| Molecular Formula | C10H10N2S |
| Molecular Weight | 190.27 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1,3,9,9a-tetrahydrothieno[3,4-b]quinoxaline |
| SMILES | c1ccc2c(c1)N=C1CSCC1N2 |
| InChI | InChI=1S/C10H10N2S/c1-2-4-8-7(3-1)11-9-5-13-6-10(9)12-8/h1-4,9,11H,5-6H2 |
| InChIKey | WBEHBJIJKKPMKH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |