C24H17BrN2O2 — CID 2835695
2-[2-(4-bromophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]indene-1,3-dione (PubChem CID 2835695) has the molecular formula C24H17BrN2O2 and a molecular weight of 445.32 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]indene-1,3-dione.
| Compound Name | 2-[2-(4-bromophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]indene-1,3-dione |
|---|---|
| PubChem CID | 2835695 |
| Molecular Formula | C24H17BrN2O2 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]indene-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)C1C1=Nc2ccccc2NC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C24H17BrN2O2/c25-15-11-9-14(10-12-15)20-13-21(27-19-8-4-3-7-18(19)26-20)22-23(28)16-5-1-2-6-17(16)24(22)29/h1-12,20,22,26H,13H2 |
| InChIKey | XVVVVXCLMFYDBY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|