C28H27N3O2 — CID 163139683
2-[2-[4-(diethylamino)phenyl]-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-3-hydroxyinden-1-one (PubChem CID 163139683) has the molecular formula C28H27N3O2 and a molecular weight of 437.54 g/mol. Its IUPAC name is 2-[2-[4-(diethylamino)phenyl]-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-3-hydroxyinden-1-one.
| Compound Name | 2-[2-[4-(diethylamino)phenyl]-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-3-hydroxyinden-1-one |
|---|---|
| PubChem CID | 163139683 |
| Molecular Formula | C28H27N3O2 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | 2-[2-[4-(diethylamino)phenyl]-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]-3-hydroxyinden-1-one |
| SMILES | CCN(CC)c1ccc(C2CC(C3=C(O)c4ccccc4C3=O)=Nc3ccccc3N2)cc1 |
| InChI | InChI=1S/C28H27N3O2/c1-3-31(4-2)19-15-13-18(14-16-19)24-17-25(30-23-12-8-7-11-22(23)29-24)26-27(32)20-9-5-6-10-21(20)28(26)33/h5-16,24,29,32H,3-4,17H2,1-2H3 |
| InChIKey | JIBJHGVFCDNDMQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|