C24H18N2O3 — CID 163155265
3-hydroxy-2-[(2S)-2-(4-hydroxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]inden-1-one (PubChem CID 163155265) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-hydroxy-2-[(2S)-2-(4-hydroxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]inden-1-one.
| Compound Name | 3-hydroxy-2-[(2S)-2-(4-hydroxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]inden-1-one |
|---|---|
| PubChem CID | 163155265 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-hydroxy-2-[(2S)-2-(4-hydroxyphenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]inden-1-one |
| SMILES | O=C1C(C2=Nc3ccccc3N[C@H](c3ccc(O)cc3)C2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C24H18N2O3/c27-15-11-9-14(10-12-15)20-13-21(26-19-8-4-3-7-18(19)25-20)22-23(28)16-5-1-2-6-17(16)24(22)29/h1-12,20,25,27-28H,13H2/t20-/m0/s1 |
| InChIKey | OWAQHZFGOYOKBB-FQEVSTJZSA-N |
| XLogP | 5.19 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'} |
|---|