C24H19N3O4 — CID 163160776
N-hydroxy-3-[(2R)-4-(1-hydroxy-3-oxoinden-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-2-yl]benzeneamine oxide (PubChem CID 163160776) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-hydroxy-3-[(2R)-4-(1-hydroxy-3-oxoinden-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-2-yl]benzeneamine oxide.
| Compound Name | N-hydroxy-3-[(2R)-4-(1-hydroxy-3-oxoinden-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-2-yl]benzeneamine oxide |
|---|---|
| PubChem CID | 163160776 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-hydroxy-3-[(2R)-4-(1-hydroxy-3-oxoinden-2-yl)-2,3-dihydro-1H-1,5-benzodiazepin-2-yl]benzeneamine oxide |
| SMILES | O=C1C(C2=Nc3ccccc3N[C@@H](c3cccc([NH+]([O-])O)c3)C2)=C(O)c2ccccc21 |
| InChI | InChI=1S/C24H19N3O4/c28-23-16-8-1-2-9-17(16)24(29)22(23)21-13-20(14-6-5-7-15(12-14)27(30)31)25-18-10-3-4-11-19(18)26-21/h1-12,20,25,27-28,30H,13H2/t20-/m1/s1 |
| InChIKey | QWXVRSBSBDNJTK-HXUWFJFHSA-N |
| XLogP | 3.88 |
| TPSA | 109.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|