C25H19N3O5 — CID 135456417
7-hydroxy-4-methyl-8-[2-(3-nitrophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]chromen-2-one (PubChem CID 135456417) has the molecular formula C25H19N3O5 and a molecular weight of 441.44 g/mol. Its IUPAC name is 7-hydroxy-4-methyl-8-[2-(3-nitrophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]chromen-2-one.
| Compound Name | 7-hydroxy-4-methyl-8-[2-(3-nitrophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 135456417 |
| Molecular Formula | C25H19N3O5 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 7-hydroxy-4-methyl-8-[2-(3-nitrophenyl)-2,3-dihydro-1H-1,5-benzodiazepin-4-yl]chromen-2-one |
| SMILES | Cc1cc(=O)oc2c(C3=Nc4ccccc4NC(c4cccc([N+](=O)[O-])c4)C3)c(O)ccc12 |
| InChI | InChI=1S/C25H19N3O5/c1-14-11-23(30)33-25-17(14)9-10-22(29)24(25)21-13-20(15-5-4-6-16(12-15)28(31)32)26-18-7-2-3-8-19(18)27-21/h2-12,20,26,29H,13H2,1H3 |
| InChIKey | JJAZVRHJPMILFR-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|