C20H26ClN2O3+ — CID 9137166
(5-chloro-2-methoxyphenyl)methyl-methyl-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]azanium (PubChem CID 9137166) has the molecular formula C20H26ClN2O3+ and a molecular weight of 377.89 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)methyl-methyl-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]azanium.
| Compound Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9137166 |
| Molecular Formula | C20H26ClN2O3+ |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)methyl-methyl-[2-[2-(3-methylphenoxy)ethylamino]-2-oxoethyl]azanium |
| SMILES | COc1ccc(Cl)cc1C[NH+](C)CC(=O)NCCOc1cccc(C)c1 |
| InChI | InChI=1S/C20H25ClN2O3/c1-15-5-4-6-18(11-15)26-10-9-22-20(24)14-23(2)13-16-12-17(21)7-8-19(16)25-3/h4-8,11-12H,9-10,13-14H2,1-3H3,(H,22,24)/p+1 |
| InChIKey | VPKASQBUSZUWGH-UHFFFAOYSA-O |
| XLogP | 1.87 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|