C28H29ClN3O3+ — CID 91371753
(2R)-N-[[2-(aminomethyl)-5-chlorophenyl]methyl]-1-(9-hydroxyfluorene-9-carbonyl)-2-methylpyrrolidin-1-ium-1-carboxamide (PubChem CID 91371753) has the molecular formula C28H29ClN3O3+ and a molecular weight of 491.01 g/mol. Its IUPAC name is (2R)-N-[[2-(aminomethyl)-5-chlorophenyl]methyl]-1-(9-hydroxyfluorene-9-carbonyl)-2-methylpyrrolidin-1-ium-1-carboxamide.
| Compound Name | (2R)-N-[[2-(aminomethyl)-5-chlorophenyl]methyl]-1-(9-hydroxyfluorene-9-carbonyl)-2-methylpyrrolidin-1-ium-1-carboxamide |
|---|---|
| PubChem CID | 91371753 |
| Molecular Formula | C28H29ClN3O3+ |
| Molecular Weight | 491.01 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | (2R)-N-[[2-(aminomethyl)-5-chlorophenyl]methyl]-1-(9-hydroxyfluorene-9-carbonyl)-2-methylpyrrolidin-1-ium-1-carboxamide |
| SMILES | C[C@@H]1CCC[N+]1(C(=O)NCc1cc(Cl)ccc1CN)C(=O)C1(O)c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C28H28ClN3O3/c1-18-7-6-14-32(18,27(34)31-17-20-15-21(29)13-12-19(20)16-30)26(33)28(35)24-10-4-2-8-22(24)23-9-3-5-11-25(23)28/h2-5,8-13,15,18,35H,6-7,14,16-17,30H2,1H3/p+1/t18-,32?/m1/s1 |
| InChIKey | XYYOBVMVJDDDBQ-DTWMZXIHSA-O |
| XLogP | 4.45 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.01 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|