C22H20F5N3O3 — CID 91372710
N-(2,4-difluorophenyl)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propanamide (PubChem CID 91372710) has the molecular formula C22H20F5N3O3 and a molecular weight of 469.41 g/mol. Its IUPAC name is N-(2,4-difluorophenyl)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propanamide.
| Compound Name | N-(2,4-difluorophenyl)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propanamide |
|---|---|
| PubChem CID | 91372710 |
| Molecular Formula | C22H20F5N3O3 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | N-(2,4-difluorophenyl)-3-oxo-3-[4-[[3-(trifluoromethyl)phenyl]methoxyamino]-3,6-dihydro-2H-pyridin-1-yl]propanamide |
| SMILES | O=C(CC(=O)N1CC=C(NOCc2cccc(C(F)(F)F)c2)CC1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C22H20F5N3O3/c23-16-4-5-19(18(24)11-16)28-20(31)12-21(32)30-8-6-17(7-9-30)29-33-13-14-2-1-3-15(10-14)22(25,26)27/h1-6,10-11,29H,7-9,12-13H2,(H,28,31) |
| InChIKey | OEBWKMXEEPMXPI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|