C16H11ClF6N2 — CID 91373187
4-[2,6-bis(trifluoromethyl)phenyl]-6-chloro-2-methyl-5-prop-2-enylpyrimidine (PubChem CID 91373187) has the molecular formula C16H11ClF6N2 and a molecular weight of 380.72 g/mol. Its IUPAC name is 4-[2,6-bis(trifluoromethyl)phenyl]-6-chloro-2-methyl-5-prop-2-enylpyrimidine.
| Compound Name | 4-[2,6-bis(trifluoromethyl)phenyl]-6-chloro-2-methyl-5-prop-2-enylpyrimidine |
|---|---|
| PubChem CID | 91373187 |
| Molecular Formula | C16H11ClF6N2 |
| Molecular Weight | 380.72 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 4-[2,6-bis(trifluoromethyl)phenyl]-6-chloro-2-methyl-5-prop-2-enylpyrimidine |
| SMILES | C=CCc1c(Cl)nc(C)nc1-c1c(C(F)(F)F)cccc1C(F)(F)F |
| InChI | InChI=1S/C16H11ClF6N2/c1-3-5-9-13(24-8(2)25-14(9)17)12-10(15(18,19)20)6-4-7-11(12)16(21,22)23/h3-4,6-7H,1,5H2,2H3 |
| InChIKey | RRDHPSURYXBMNP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.72 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|