C31H35NO3 — CID 91373244
(1S,3aR,3bS,11aS)-10-[4-(dimethylamino)phenyl]-1-hydroxy-11a-methyl-1-phenyl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one (PubChem CID 91373244) has the molecular formula C31H35NO3 and a molecular weight of 469.63 g/mol. Its IUPAC name is (1S,3aR,3bS,11aS)-10-[4-(dimethylamino)phenyl]-1-hydroxy-11a-methyl-1-phenyl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one.
| Compound Name | (1S,3aR,3bS,11aS)-10-[4-(dimethylamino)phenyl]-1-hydroxy-11a-methyl-1-phenyl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one |
|---|---|
| PubChem CID | 91373244 |
| Molecular Formula | C31H35NO3 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | (1S,3aR,3bS,11aS)-10-[4-(dimethylamino)phenyl]-1-hydroxy-11a-methyl-1-phenyl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one |
| SMILES | CN(C)c1ccc(C2C[C@@]3(C)[C@@H](CC[C@@]3(O)c3ccccc3)[C@@H]3OC=C4CC(=O)CCC4=C23)cc1 |
| InChI | InChI=1S/C31H35NO3/c1-30-18-26(20-9-11-23(12-10-20)32(2)3)28-25-14-13-24(33)17-21(25)19-35-29(28)27(30)15-16-31(30,34)22-7-5-4-6-8-22/h4-12,19,26-27,29,34H,13-18H2,1-3H3/t26?,27-,29-,30-,31+/m0/s1 |
| InChIKey | PCEOGTOPQXQAMC-WJSBDDNSSA-N |
| XLogP | 5.88 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|