C24H26O3S — CID 91073135
(1S,3aR,3bS,11aS)-1-hydroxy-11a-methyl-1-prop-1-ynyl-10-thiophen-2-yl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one (PubChem CID 91073135) has the molecular formula C24H26O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is (1S,3aR,3bS,11aS)-1-hydroxy-11a-methyl-1-prop-1-ynyl-10-thiophen-2-yl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one.
| Compound Name | (1S,3aR,3bS,11aS)-1-hydroxy-11a-methyl-1-prop-1-ynyl-10-thiophen-2-yl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one |
|---|---|
| PubChem CID | 91073135 |
| Molecular Formula | C24H26O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (1S,3aR,3bS,11aS)-1-hydroxy-11a-methyl-1-prop-1-ynyl-10-thiophen-2-yl-3,3a,3b,6,8,9,10,11-octahydro-2H-indeno[4,5-c]isochromen-7-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3OC=C4CC(=O)CCC4=C3C(c3cccs3)C[C@@]21C |
| InChI | InChI=1S/C24H26O3S/c1-3-9-24(26)10-8-19-22-21(17-7-6-16(25)12-15(17)14-27-22)18(13-23(19,24)2)20-5-4-11-28-20/h4-5,11,14,18-19,22,26H,6-8,10,12-13H2,1-2H3/t18?,19-,22-,23-,24-/m0/s1 |
| InChIKey | FTVUPWMJIJZZLP-XKABYSEWSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|