C14H11ClF2N2O2 — CID 91373344
5-(2-chloro-2-nitrosoethyl)-2-[(2,4-difluorophenyl)methoxy]pyridine (PubChem CID 91373344) has the molecular formula C14H11ClF2N2O2 and a molecular weight of 312.70 g/mol. Its IUPAC name is 5-(2-chloro-2-nitrosoethyl)-2-[(2,4-difluorophenyl)methoxy]pyridine.
| Compound Name | 5-(2-chloro-2-nitrosoethyl)-2-[(2,4-difluorophenyl)methoxy]pyridine |
|---|---|
| PubChem CID | 91373344 |
| Molecular Formula | C14H11ClF2N2O2 |
| Molecular Weight | 312.70 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 5-(2-chloro-2-nitrosoethyl)-2-[(2,4-difluorophenyl)methoxy]pyridine |
| SMILES | O=NC(Cl)Cc1ccc(OCc2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C14H11ClF2N2O2/c15-13(19-20)5-9-1-4-14(18-7-9)21-8-10-2-3-11(16)6-12(10)17/h1-4,6-7,13H,5,8H2 |
| InChIKey | AEJNSFWKBXXOIS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.70 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|