C7H5F2NO2 — CID 174767305
(2,4-difluorophenyl)methyl nitrite (PubChem CID 174767305) has the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. Its IUPAC name is (2,4-difluorophenyl)methyl nitrite.
| Compound Name | (2,4-difluorophenyl)methyl nitrite |
|---|---|
| PubChem CID | 174767305 |
| Molecular Formula | C7H5F2NO2 |
| Molecular Weight | 173.12 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (2,4-difluorophenyl)methyl nitrite |
| SMILES | O=NOCc1ccc(F)cc1F |
| InChI | InChI=1S/C7H5F2NO2/c8-6-2-1-5(4-12-10-11)7(9)3-6/h1-3H,4H2 |
| InChIKey | PMWCRJNNWWAAEH-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.12 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|