C22H26O4 — CID 91373883
(8S,10R,13S,14S,17R)-10,13-dimethylspiro[1,2,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione (PubChem CID 91373883) has the molecular formula C22H26O4 and a molecular weight of 354.45 g/mol. Its IUPAC name is (8S,10R,13S,14S,17R)-10,13-dimethylspiro[1,2,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione.
| Compound Name | (8S,10R,13S,14S,17R)-10,13-dimethylspiro[1,2,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione |
|---|---|
| PubChem CID | 91373883 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (8S,10R,13S,14S,17R)-10,13-dimethylspiro[1,2,8,9,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3,11-trione |
| SMILES | C[C@]12CCC(=O)C=C1C=C[C@@H]1C2C(=O)C[C@@]2(C)[C@H]1CC[C@@]21CCC(=O)O1 |
| InChI | InChI=1S/C22H26O4/c1-20-8-5-14(23)11-13(20)3-4-15-16-6-9-22(10-7-18(25)26-22)21(16,2)12-17(24)19(15)20/h3-4,11,15-16,19H,5-10,12H2,1-2H3/t15-,16-,19?,20-,21-,22+/m0/s1 |
| InChIKey | FMZGVTXDEUOLOJ-DUDKWJDBSA-N |
| XLogP | 3.55 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |