C24H21NO5 — CID 91376136
2-(3-formylphenyl)-7-methoxy-8-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-oxochromene-5-carbaldehyde (PubChem CID 91376136) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is 2-(3-formylphenyl)-7-methoxy-8-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-oxochromene-5-carbaldehyde.
| Compound Name | 2-(3-formylphenyl)-7-methoxy-8-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-oxochromene-5-carbaldehyde |
|---|---|
| PubChem CID | 91376136 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | 2-(3-formylphenyl)-7-methoxy-8-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)-4-oxochromene-5-carbaldehyde |
| SMILES | COc1cc(C=O)c2c(=O)cc(-c3cccc(C=O)c3)oc2c1C1=CCN(C)CC1 |
| InChI | InChI=1S/C24H21NO5/c1-25-8-6-16(7-9-25)23-21(29-2)11-18(14-27)22-19(28)12-20(30-24(22)23)17-5-3-4-15(10-17)13-26/h3-6,10-14H,7-9H2,1-2H3 |
| InChIKey | PNZJPOOQYDKGQI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|