C28H31F2N3O2 — CID 91376210
2-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol (PubChem CID 91376210) has the molecular formula C28H31F2N3O2 and a molecular weight of 479.57 g/mol. Its IUPAC name is 2-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol.
| Compound Name | 2-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91376210 |
| Molecular Formula | C28H31F2N3O2 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-[3-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]propyl]-4,7-dihydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1CCCN1CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC1)CC=CC2 |
| InChI | InChI=1S/C28H31F2N3O2/c29-22-10-6-20(7-11-22)26(21-8-12-23(30)13-9-21)32-18-16-31(17-19-32)14-3-15-33-27(34)24-4-1-2-5-25(24)28(33)35/h1-2,6-13,26,34-35H,3-5,14-19H2 |
| InChIKey | LBPREOYGESFEEI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 51.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|