C16H20F3NO4S — CID 91376884
tert-butyl 4-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]but-2-enoate (PubChem CID 91376884) has the molecular formula C16H20F3NO4S and a molecular weight of 379.40 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]but-2-enoate.
| Compound Name | tert-butyl 4-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]but-2-enoate |
|---|---|
| PubChem CID | 91376884 |
| Molecular Formula | C16H20F3NO4S |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | tert-butyl 4-[methyl-[2-(trifluoromethyl)phenyl]sulfonylamino]but-2-enoate |
| SMILES | CN(CC=CC(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H20F3NO4S/c1-15(2,3)24-14(21)10-7-11-20(4)25(22,23)13-9-6-5-8-12(13)16(17,18)19/h5-10H,11H2,1-4H3 |
| InChIKey | OMRGTFUXUMYIFI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|