C10H15N3 — CID 91377292
4-methyl-2,3,9,9a-tetrahydro-1H-1,4-benzodiazepin-8-imine (PubChem CID 91377292) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 4-methyl-2,3,9,9a-tetrahydro-1H-1,4-benzodiazepin-8-imine.
| Compound Name | 4-methyl-2,3,9,9a-tetrahydro-1H-1,4-benzodiazepin-8-imine |
|---|---|
| PubChem CID | 91377292 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 4-methyl-2,3,9,9a-tetrahydro-1H-1,4-benzodiazepin-8-imine |
| SMILES | [H]/N=C1\C=CC2=CN(C)CCNC2C1 |
| InChI | InChI=1S/C10H15N3/c1-13-5-4-12-10-6-9(11)3-2-8(10)7-13/h2-3,7,10-12H,4-6H2,1H3/b11-9+ |
| InChIKey | KZRHCJMMVUAYLN-PKNBQFBNSA-N |
| XLogP | 0.75 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|