C23H31N2O+ — CID 91378098
[6-(aminomethyl)-3,4,4a,5-tetrahydro-1H-isoquinolin-2-yl]-(4-ethyl-3,4,4a,5,6,8a-hexahydronaphthalen-2-yl)methanone (PubChem CID 91378098) has the molecular formula C23H31N2O+ and a molecular weight of 351.51 g/mol. Its IUPAC name is [6-(aminomethyl)-3,4,4a,5-tetrahydro-1H-isoquinolin-2-yl]-(4-ethyl-3,4,4a,5,6,8a-hexahydronaphthalen-2-yl)methanone.
| Compound Name | [6-(aminomethyl)-3,4,4a,5-tetrahydro-1H-isoquinolin-2-yl]-(4-ethyl-3,4,4a,5,6,8a-hexahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 91378098 |
| Molecular Formula | C23H31N2O+ |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | [6-(aminomethyl)-3,4,4a,5-tetrahydro-1H-isoquinolin-2-yl]-(4-ethyl-3,4,4a,5,6,8a-hexahydronaphthalen-2-yl)methanone |
| SMILES | C[CH+]C1CC(C(=O)N2CCC3CC(CN)=CC=C3C2)=CC2C=CCCC21 |
| InChI | InChI=1S/C23H31N2O/c1-2-17-12-21(13-19-5-3-4-6-22(17)19)23(26)25-10-9-18-11-16(14-24)7-8-20(18)15-25/h2-3,5,7-8,13,17-19,22H,4,6,9-12,14-15,24H2,1H3/q+1 |
| InChIKey | ZQCLCNKTIQAOQQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|