C37H41N5O4 — CID 91378408
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-[4-(1-phenylethyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 91378408) has the molecular formula C37H41N5O4 and a molecular weight of 619.77 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-[4-(1-phenylethyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-[4-(1-phenylethyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 91378408 |
| Molecular Formula | C37H41N5O4 |
| Molecular Weight | 619.77 g/mol |
| Exact Mass | 619.32 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-(pyridin-2-ylamino)butyl]-4-[4-(1-phenylethyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc([C@@H](CCCNc2ccccn2)N2C(=O)c3cccc(N4CCN(C(C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H41N5O4/c1-26(27-11-5-4-6-12-27)40-21-23-41(24-22-40)31-14-9-13-29-35(31)37(44)42(36(29)43)30(15-10-20-39-34-16-7-8-19-38-34)28-17-18-32(45-2)33(25-28)46-3/h4-9,11-14,16-19,25-26,30H,10,15,20-24H2,1-3H3,(H,38,39)/t26?,30-/m1/s1 |
| InChIKey | PCODJWYXRKJUTP-NPRFROTHSA-N |
| XLogP | 6.21 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.77 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|