ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid

C19H20O3 — CID 91379845

IUPACethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid
SMILESC=C(CC(=O)c1ccc(-c2ccccc2)cc1)C(=O)O.CC
InChIInChI=1S/C17H14O3.C2H6/c1-12(17(19)20)11-16(18)15-9-7-14(8-10-15)13-5-3-2-4-6-13;1-2/h2-10H,1,11H2,(H,19,20);1-2H3
InChIKeyGBJNRMBOAUNEPF-UHFFFAOYSA-N
MW296.37 g/mol
LogP4.59
Rot. Bonds5

About ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid

ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid (PubChem CID 91379845) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid.

Molecular Properties

Compound Nameethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid
PubChem CID91379845
Molecular FormulaC19H20O3
Molecular Weight296.37 g/mol
Exact Mass296.14
IUPAC Nameethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid
SMILESC=C(CC(=O)c1ccc(-c2ccccc2)cc1)C(=O)O.CC
InChIInChI=1S/C17H14O3.C2H6/c1-12(17(19)20)11-16(18)15-9-7-14(8-10-15)13-5-3-2-4-6-13;1-2/h2-10H,1,11H2,(H,19,20);1-2H3
InChIKeyGBJNRMBOAUNEPF-UHFFFAOYSA-N
XLogP4.59
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.37
LogP ≤ 54.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid?
The IUPAC name of ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid (CID 91379845) is ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid.
What is the SMILES notation for ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid?
The canonical SMILES for ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid is C=C(CC(=O)c1ccc(-c2ccccc2)cc1)C(=O)O.CC.
What is the InChIKey of ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid?
The InChIKey is GBJNRMBOAUNEPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O3.C2H6/c1-12(17(19)20)11-16(18)15-9-7-14(8-10-15)13-5-3-2-4-6-13;1-2/h2-10H,1,11H2,(H,19,20);1-2H3.
What are the key properties of ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid?
ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid has a molecular weight of 296.37 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylidene-4-oxo-4-(4-phenylphenyl)butanoic acid is sourced from PubChem (CID 91379845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).