C12H14N4OS — CID 91381427
(7-methylthieno[3,2-d]pyrimidin-4-yl)-(oxolan-3-ylmethyl)diazene (PubChem CID 91381427) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is (7-methylthieno[3,2-d]pyrimidin-4-yl)-(oxolan-3-ylmethyl)diazene.
| Compound Name | (7-methylthieno[3,2-d]pyrimidin-4-yl)-(oxolan-3-ylmethyl)diazene |
|---|---|
| PubChem CID | 91381427 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | (7-methylthieno[3,2-d]pyrimidin-4-yl)-(oxolan-3-ylmethyl)diazene |
| SMILES | Cc1csc2c(/N=N/CC3CCOC3)ncnc12 |
| InChI | InChI=1S/C12H14N4OS/c1-8-6-18-11-10(8)13-7-14-12(11)16-15-4-9-2-3-17-5-9/h6-7,9H,2-5H2,1H3/b16-15+ |
| InChIKey | UJUGIUSOZDEWNH-FOCLMDBBSA-N |
| XLogP | 3.12 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|