C14H12N4OS — CID 90936081
3-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]phenol (PubChem CID 90936081) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]phenol.
| Compound Name | 3-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]phenol |
|---|---|
| PubChem CID | 90936081 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | 3-[[(7-methylthieno[3,2-d]pyrimidin-4-yl)diazenyl]methyl]phenol |
| SMILES | Cc1csc2c(/N=N/Cc3cccc(O)c3)ncnc12 |
| InChI | InChI=1S/C14H12N4OS/c1-9-7-20-13-12(9)15-8-16-14(13)18-17-6-10-3-2-4-11(19)5-10/h2-5,7-8,19H,6H2,1H3/b18-17+ |
| InChIKey | QGLVQUOYICMWMQ-ISLYRVAYSA-N |
| XLogP | 3.99 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|