C11H14N4S — CID 91591966
butyl-(7-methylthieno[3,2-d]pyrimidin-4-yl)diazene (PubChem CID 91591966) has the molecular formula C11H14N4S and a molecular weight of 234.33 g/mol. Its IUPAC name is butyl-(7-methylthieno[3,2-d]pyrimidin-4-yl)diazene.
| Compound Name | butyl-(7-methylthieno[3,2-d]pyrimidin-4-yl)diazene |
|---|---|
| PubChem CID | 91591966 |
| Molecular Formula | C11H14N4S |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | butyl-(7-methylthieno[3,2-d]pyrimidin-4-yl)diazene |
| SMILES | CCCC/N=N/c1ncnc2c(C)csc12 |
| InChI | InChI=1S/C11H14N4S/c1-3-4-5-14-15-11-10-9(12-7-13-11)8(2)6-16-10/h6-7H,3-5H2,1-2H3/b15-14+ |
| InChIKey | WKRPVBUBKHODGO-CCEZHUSRSA-N |
| XLogP | 3.88 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|