C14H13N5S — CID 90924504
(7-ethylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-3-ylmethyl)diazene (PubChem CID 90924504) has the molecular formula C14H13N5S and a molecular weight of 283.36 g/mol. Its IUPAC name is (7-ethylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-3-ylmethyl)diazene.
| Compound Name | (7-ethylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-3-ylmethyl)diazene |
|---|---|
| PubChem CID | 90924504 |
| Molecular Formula | C14H13N5S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (7-ethylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-3-ylmethyl)diazene |
| SMILES | CCc1csc2c(/N=N/Cc3cccnc3)ncnc12 |
| InChI | InChI=1S/C14H13N5S/c1-2-11-8-20-13-12(11)16-9-17-14(13)19-18-7-10-4-3-5-15-6-10/h3-6,8-9H,2,7H2,1H3/b19-18+ |
| InChIKey | DOJVROJTMIJUDD-VHEBQXMUSA-N |
| XLogP | 3.93 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|