C13H10IN5S — CID 91472470
(6-iodo-7-methylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-2-ylmethyl)diazene (PubChem CID 91472470) has the molecular formula C13H10IN5S and a molecular weight of 395.23 g/mol. Its IUPAC name is (6-iodo-7-methylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-2-ylmethyl)diazene.
| Compound Name | (6-iodo-7-methylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-2-ylmethyl)diazene |
|---|---|
| PubChem CID | 91472470 |
| Molecular Formula | C13H10IN5S |
| Molecular Weight | 395.23 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | (6-iodo-7-methylthieno[3,2-d]pyrimidin-4-yl)-(pyridin-2-ylmethyl)diazene |
| SMILES | Cc1c(I)sc2c(/N=N/Cc3ccccn3)ncnc12 |
| InChI | InChI=1S/C13H10IN5S/c1-8-10-11(20-12(8)14)13(17-7-16-10)19-18-6-9-4-2-3-5-15-9/h2-5,7H,6H2,1H3/b19-18+ |
| InChIKey | QJZMECIZIXUBOX-VHEBQXMUSA-N |
| XLogP | 4.28 |
| TPSA | 63.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|