C10H10N6O — CID 136634911
6-methyl-3-(pyridin-2-ylmethyldiazenyl)-4H-1,2,4-triazin-5-one (PubChem CID 136634911) has the molecular formula C10H10N6O and a molecular weight of 230.23 g/mol. Its IUPAC name is 6-methyl-3-(pyridin-2-ylmethyldiazenyl)-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-(pyridin-2-ylmethyldiazenyl)-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136634911 |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 6-methyl-3-(pyridin-2-ylmethyldiazenyl)-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(/N=N/Cc2ccccn2)[nH]c1=O |
| InChI | InChI=1S/C10H10N6O/c1-7-9(17)13-10(16-14-7)15-12-6-8-4-2-3-5-11-8/h2-5H,6H2,1H3,(H,13,16,17)/b15-12+ |
| InChIKey | RVEPOIXYFYRBHH-NTCAYCPXSA-N |
| XLogP | 1.15 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|